C11H8F3N3O2 — CID 9350659
1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 9350659) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9350659 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | O=C1CN(/N=C\c2ccc(C(F)(F)F)cc2)C(=O)N1 |
| InChI | InChI=1S/C11H8F3N3O2/c12-11(13,14)8-3-1-7(2-4-8)5-15-17-6-9(18)16-10(17)19/h1-5H,6H2,(H,16,18,19)/b15-5- |
| InChIKey | PDXHCXRDKHTFTM-WCSRMQSCSA-N |
| XLogP | 1.59 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|