C21H15F3N4O — CID 123214559
3-(pyridin-3-ylmethylideneamino)-6-[4-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-one (PubChem CID 123214559) has the molecular formula C21H15F3N4O and a molecular weight of 396.37 g/mol. Its IUPAC name is 3-(pyridin-3-ylmethylideneamino)-6-[4-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-(pyridin-3-ylmethylideneamino)-6-[4-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 123214559 |
| Molecular Formula | C21H15F3N4O |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-(pyridin-3-ylmethylideneamino)-6-[4-(trifluoromethyl)phenyl]-1,4-dihydroquinazolin-2-one |
| SMILES | O=C1Nc2ccc(-c3ccc(C(F)(F)F)cc3)cc2CN1N=Cc1cccnc1 |
| InChI | InChI=1S/C21H15F3N4O/c22-21(23,24)18-6-3-15(4-7-18)16-5-8-19-17(10-16)13-28(20(29)27-19)26-12-14-2-1-9-25-11-14/h1-12H,13H2,(H,27,29) |
| InChIKey | AYMAPQISNMJMSR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|