C17H18F3N3O2 — CID 6911594
8-methyl-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 6911594) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 8-methyl-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methyl-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 6911594 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 8-methyl-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(/N=C/c1ccc(C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C17H18F3N3O2/c1-11-6-8-16(9-7-11)14(24)23(15(25)22-16)21-10-12-2-4-13(5-3-12)17(18,19)20/h2-5,10-11H,6-9H2,1H3,(H,22,25)/b21-10+ |
| InChIKey | XMLLSYWCYXFPTL-UFFVCSGVSA-N |
| XLogP | 3.54 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|