C15H17N3O4 — CID 3561014
3-[(3,4-dihydroxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 3561014) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-[(3,4-dihydroxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(3,4-dihydroxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 3561014 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1N=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H17N3O4/c19-11-5-4-10(8-12(11)20)9-16-18-13(21)15(17-14(18)22)6-2-1-3-7-15/h4-5,8-9,19-20H,1-3,6-7H2,(H,17,22) |
| InChIKey | DVBRLADUZQKHPP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|