C19H19N3O2 — CID 2643505
3-(naphthalen-1-ylmethylideneamino)-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2643505) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-(naphthalen-1-ylmethylideneamino)-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(naphthalen-1-ylmethylideneamino)-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2643505 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-(naphthalen-1-ylmethylideneamino)-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1N=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C19H19N3O2/c23-17-19(11-4-1-5-12-19)21-18(24)22(17)20-13-15-9-6-8-14-7-2-3-10-16(14)15/h2-3,6-10,13H,1,4-5,11-12H2,(H,21,24) |
| InChIKey | MEJDQNISICRSTA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|