C16H16N3O4- — CID 2643535
4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)iminomethyl]benzoate (PubChem CID 2643535) has the molecular formula C16H16N3O4- and a molecular weight of 314.32 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)iminomethyl]benzoate.
| Compound Name | 4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 2643535 |
| Molecular Formula | C16H16N3O4- |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)iminomethyl]benzoate |
| SMILES | O=C([O-])c1ccc(C=NN2C(=O)NC3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C16H17N3O4/c20-13(21)12-6-4-11(5-7-12)10-17-19-14(22)16(18-15(19)23)8-2-1-3-9-16/h4-7,10H,1-3,8-9H2,(H,18,23)(H,20,21)/p-1 |
| InChIKey | AAYGZWAPGSZKLR-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|