C17H21N3O3 — CID 9395752
3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9395752) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9395752 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=N\N2C(=O)NC3(CCCCC3)C2=O)o1 |
| InChI | InChI=1S/C17H21N3O3/c1-11-9-13(11)14-6-5-12(23-14)10-18-20-15(21)17(19-16(20)22)7-3-2-4-8-17/h5-6,10-11,13H,2-4,7-9H2,1H3,(H,19,22)/b18-10-/t11-,13-/m1/s1 |
| InChIKey | KADJCKQPAGEALV-YXKOMOBRSA-N |
| XLogP | 2.99 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|