C17H14N2O3 — CID 9391238
2-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]isoindole-1,3-dione (PubChem CID 9391238) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9391238 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]isoindole-1,3-dione |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=N\N2C(=O)c3ccccc3C2=O)o1 |
| InChI | InChI=1S/C17H14N2O3/c1-10-8-14(10)15-7-6-11(22-15)9-18-19-16(20)12-4-2-3-5-13(12)17(19)21/h2-7,9-10,14H,8H2,1H3/b18-9-/t10-,14-/m1/s1 |
| InChIKey | BTMIMWWCVGYHLM-UCBXJQBOSA-N |
| XLogP | 3.03 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|