C21H20N6O3 — CID 9043143
1-[(Z)-[4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]phenyl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 9043143) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-[(Z)-[4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]phenyl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[(Z)-[4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]phenyl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9043143 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-[(Z)-[4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]phenyl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | Cc1c(Nc2ccc(/C=N\N3CC(=O)NC3=O)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H20N6O3/c1-14-19(20(29)27(25(14)2)17-6-4-3-5-7-17)23-16-10-8-15(9-11-16)12-22-26-13-18(28)24-21(26)30/h3-12,23H,13H2,1-2H3,(H,24,28,30)/b22-12- |
| InChIKey | JZVDHWOMNIJSME-UUYOSTAYSA-N |
| XLogP | 2.11 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|