C19H22IN3O2 — CID 4993269
4-[(2-iodo-5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 4993269) has the molecular formula C19H22IN3O2 and a molecular weight of 451.31 g/mol. Its IUPAC name is 4-[(2-iodo-5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(2-iodo-5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4993269 |
| Molecular Formula | C19H22IN3O2 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-[(2-iodo-5,5-dimethyl-3-oxocyclohexen-1-yl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(NC2=C(I)C(=O)CC(C)(C)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H22IN3O2/c1-12-17(21-14-10-19(2,3)11-15(24)16(14)20)18(25)23(22(12)4)13-8-6-5-7-9-13/h5-9,21H,10-11H2,1-4H3 |
| InChIKey | LIVXWHLKNFLLNO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|