C10H9N3O7 — CID 154105430
[3-[(5-nitrofuran-2-yl)methylideneamino]-2-oxo-1,3-oxazolidin-5-yl]methyl formate (PubChem CID 154105430) has the molecular formula C10H9N3O7 and a molecular weight of 283.20 g/mol. Its IUPAC name is [3-[(5-nitrofuran-2-yl)methylideneamino]-2-oxo-1,3-oxazolidin-5-yl]methyl formate.
| Compound Name | [3-[(5-nitrofuran-2-yl)methylideneamino]-2-oxo-1,3-oxazolidin-5-yl]methyl formate |
|---|---|
| PubChem CID | 154105430 |
| Molecular Formula | C10H9N3O7 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | [3-[(5-nitrofuran-2-yl)methylideneamino]-2-oxo-1,3-oxazolidin-5-yl]methyl formate |
| SMILES | O=COCC1CN(N=Cc2ccc([N+](=O)[O-])o2)C(=O)O1 |
| InChI | InChI=1S/C10H9N3O7/c14-6-18-5-8-4-12(10(15)20-8)11-3-7-1-2-9(19-7)13(16)17/h1-3,6,8H,4-5H2 |
| InChIKey | VBJWRJBIIWTOOP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 124.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|