C13H17N4O6+ — CID 24848395
5-(morpholin-4-ium-4-ylmethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one (PubChem CID 24848395) has the molecular formula C13H17N4O6+ and a molecular weight of 325.30 g/mol. Its IUPAC name is 5-(morpholin-4-ium-4-ylmethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one.
| Compound Name | 5-(morpholin-4-ium-4-ylmethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24848395 |
| Molecular Formula | C13H17N4O6+ |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-(morpholin-4-ium-4-ylmethyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(C[NH+]2CCOCC2)CN1N=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H16N4O6/c18-13-16(14-7-10-1-2-12(22-10)17(19)20)9-11(23-13)8-15-3-5-21-6-4-15/h1-2,7,11H,3-6,8-9H2/p+1 |
| InChIKey | YVQVOQKFMFRVGR-UHFFFAOYSA-O |
| XLogP | -0.74 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|