C13H17ClN4O7 — CID 129318862
3-[(5-nitrofuran-2-yl)methylideneamino]-5-[(4-oxidomorpholin-4-ium-4-yl)methyl]-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 129318862) has the molecular formula C13H17ClN4O7 and a molecular weight of 376.75 g/mol. Its IUPAC name is 3-[(5-nitrofuran-2-yl)methylideneamino]-5-[(4-oxidomorpholin-4-ium-4-yl)methyl]-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | 3-[(5-nitrofuran-2-yl)methylideneamino]-5-[(4-oxidomorpholin-4-ium-4-yl)methyl]-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 129318862 |
| Molecular Formula | C13H17ClN4O7 |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-[(5-nitrofuran-2-yl)methylideneamino]-5-[(4-oxidomorpholin-4-ium-4-yl)methyl]-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1OC(C[N+]2([O-])CCOCC2)CN1N=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H16N4O7.ClH/c18-13-15(14-7-10-1-2-12(23-10)16(19)20)8-11(24-13)9-17(21)3-5-22-6-4-17;/h1-2,7,11H,3-6,8-9H2;1H |
| InChIKey | IBMBHGROFDBUQU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 130.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|