C19H22IN5O8 — CID 54605264
3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-[[1-[(5-nitrofuran-2-yl)methyl]piperidin-1-ium-1-yl]methyl]-1,3-oxazolidin-2-one iodide (PubChem CID 54605264) has the molecular formula C19H22IN5O8 and a molecular weight of 575.32 g/mol. Its IUPAC name is 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-[[1-[(5-nitrofuran-2-yl)methyl]piperidin-1-ium-1-yl]methyl]-1,3-oxazolidin-2-one iodide.
| Compound Name | 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-[[1-[(5-nitrofuran-2-yl)methyl]piperidin-1-ium-1-yl]methyl]-1,3-oxazolidin-2-one iodide |
|---|---|
| PubChem CID | 54605264 |
| Molecular Formula | C19H22IN5O8 |
| Molecular Weight | 575.32 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-[[1-[(5-nitrofuran-2-yl)methyl]piperidin-1-ium-1-yl]methyl]-1,3-oxazolidin-2-one iodide |
| SMILES | O=C1OC(C[N+]2(Cc3ccc([N+](=O)[O-])o3)CCCCC2)CN1/N=C/c1ccc([N+](=O)[O-])o1.[I-] |
| InChI | InChI=1S/C19H22N5O8.HI/c25-19-21(20-10-14-4-6-17(30-14)22(26)27)11-16(32-19)13-24(8-2-1-3-9-24)12-15-5-7-18(31-15)23(28)29;/h4-7,10,16H,1-3,8-9,11-13H2;1H/q+1;/p-1/b20-10+; |
| InChIKey | ORHAWFHAIBRYBP-XZISABOOSA-M |
| XLogP | 0.05 |
| TPSA | 154.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|