C13H17ClN4O6 — CID 6321391
(5S)-5-(morpholin-4-ylmethyl)-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 6321391) has the molecular formula C13H17ClN4O6 and a molecular weight of 360.75 g/mol. Its IUPAC name is (5S)-5-(morpholin-4-ylmethyl)-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | (5S)-5-(morpholin-4-ylmethyl)-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 6321391 |
| Molecular Formula | C13H17ClN4O6 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (5S)-5-(morpholin-4-ylmethyl)-3-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1O[C@@H](CN2CCOCC2)CN1/N=C\c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H16N4O6.ClH/c18-13-16(14-7-10-1-2-12(22-10)17(19)20)9-11(23-13)8-15-3-5-21-6-4-15;/h1-2,7,11H,3-6,8-9H2;1H/b14-7-;/t11-;/m0./s1 |
| InChIKey | PPSVFZXMDMUIGB-CSTIDRAUSA-N |
| XLogP | 1.10 |
| TPSA | 110.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|