C16H19N3O5 — CID 10382156
3-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-(morpholin-4-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 10382156) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 3-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-(morpholin-4-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-(morpholin-4-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10382156 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-(morpholin-4-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CN2CCOCC2)CN1/N=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19N3O5/c20-16-19(10-13(24-16)9-18-3-5-21-6-4-18)17-8-12-1-2-14-15(7-12)23-11-22-14/h1-2,7-8,13H,3-6,9-11H2/b17-8+ |
| InChIKey | IOOVAPVPZQHGSB-CAOOACKPSA-N |
| XLogP | 0.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|