C12H16ClN3O5 — CID 54609514
5-butyl-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 54609514) has the molecular formula C12H16ClN3O5 and a molecular weight of 317.73 g/mol. Its IUPAC name is 5-butyl-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | 5-butyl-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 54609514 |
| Molecular Formula | C12H16ClN3O5 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-butyl-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | CCCCC1CN(/N=C/c2ccc([N+](=O)[O-])o2)C(=O)O1.Cl |
| InChI | InChI=1S/C12H15N3O5.ClH/c1-2-3-4-10-8-14(12(16)20-10)13-7-9-5-6-11(19-9)15(17)18;/h5-7,10H,2-4,8H2,1H3;1H/b13-7+; |
| InChIKey | NGTRSFNIHCJTIG-FTPOTTDRSA-N |
| XLogP | 2.95 |
| TPSA | 98.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|