C17H14N2O4S2 — CID 2083432
ethyl 4-[5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]furan-2-yl]benzoate (PubChem CID 2083432) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 4-[5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2083432 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | ethyl 4-[5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=NN3C(=O)CSC3=S)o2)cc1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-2-22-16(21)12-5-3-11(4-6-12)14-8-7-13(23-14)9-18-19-15(20)10-25-17(19)24/h3-9H,2,10H2,1H3 |
| InChIKey | LSDYEROUCHGHKA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|