C20H16N4O4S — CID 9461723
ethyl 4-[5-[(Z)-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 9461723) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 9461723 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | ethyl 4-[5-[(Z)-[3-(furan-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N\n3c(-c4ccco4)n[nH]c3=S)o2)cc1 |
| InChI | InChI=1S/C20H16N4O4S/c1-2-26-19(25)14-7-5-13(6-8-14)16-10-9-15(28-16)12-21-24-18(22-23-20(24)29)17-4-3-11-27-17/h3-12H,2H2,1H3,(H,23,29)/b21-12- |
| InChIKey | AMQBHXYVIZYIBO-MTJSOVHGSA-N |
| XLogP | 4.52 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|