C30H34ClN5O4 — CID 118705976
1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-[4-[4-[(2S)-2-hydroxy-2-phenylethyl]piperazin-1-yl]butyl]imidazolidine-2,4-dione (PubChem CID 118705976) has the molecular formula C30H34ClN5O4 and a molecular weight of 564.09 g/mol. Its IUPAC name is 1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-[4-[4-[(2S)-2-hydroxy-2-phenylethyl]piperazin-1-yl]butyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-[4-[4-[(2S)-2-hydroxy-2-phenylethyl]piperazin-1-yl]butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118705976 |
| Molecular Formula | C30H34ClN5O4 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 1-[(E)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-3-[4-[4-[(2S)-2-hydroxy-2-phenylethyl]piperazin-1-yl]butyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(/N=C/c2ccc(-c3ccc(Cl)cc3)o2)C(=O)N1CCCCN1CCN(C[C@@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H34ClN5O4/c31-25-10-8-24(9-11-25)28-13-12-26(40-28)20-32-36-22-29(38)35(30(36)39)15-5-4-14-33-16-18-34(19-17-33)21-27(37)23-6-2-1-3-7-23/h1-3,6-13,20,27,37H,4-5,14-19,21-22H2/b32-20+/t27-/m1/s1 |
| InChIKey | NAKOTACEMIPVOT-RLBGMPNZSA-N |
| XLogP | 4.33 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|