C15H12N4O3 — CID 3784898
methyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate (PubChem CID 3784898) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is methyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3784898 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C=Nn3cnnc3)o2)cc1 |
| InChI | InChI=1S/C15H12N4O3/c1-21-15(20)12-4-2-11(3-5-12)14-7-6-13(22-14)8-18-19-9-16-17-10-19/h2-10H,1H3 |
| InChIKey | QTAKCESTOSKHRU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|