C14H9ClN4O3 — CID 6859406
4-chloro-3-[5-[(E)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzoic acid (PubChem CID 6859406) has the molecular formula C14H9ClN4O3 and a molecular weight of 316.70 g/mol. Its IUPAC name is 4-chloro-3-[5-[(E)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[(E)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6859406 |
| Molecular Formula | C14H9ClN4O3 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-chloro-3-[5-[(E)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(-c2ccc(/C=N/n3cnnc3)o2)c1 |
| InChI | InChI=1S/C14H9ClN4O3/c15-12-3-1-9(14(20)21)5-11(12)13-4-2-10(22-13)6-18-19-7-16-17-8-19/h1-8H,(H,20,21)/b18-6+ |
| InChIKey | NDKXYEWYHPKRNR-NGYBGAFCSA-N |
| XLogP | 2.77 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|