C13H8Cl2N4O — CID 6113221
(Z)-1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6113221) has the molecular formula C13H8Cl2N4O and a molecular weight of 307.14 g/mol. Its IUPAC name is (Z)-1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6113221 |
| Molecular Formula | C13H8Cl2N4O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | (Z)-1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Clc1ccc(-c2ccc(/C=N\n3cnnc3)o2)cc1Cl |
| InChI | InChI=1S/C13H8Cl2N4O/c14-11-3-1-9(5-12(11)15)13-4-2-10(20-13)6-18-19-7-16-17-8-19/h1-8H/b18-6- |
| InChIKey | AVWUETIPVDPKII-FXBPXSCXSA-N |
| XLogP | 3.73 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|