C17H14N4O3 — CID 23904704
prop-2-enyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate (PubChem CID 23904704) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is prop-2-enyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate.
| Compound Name | prop-2-enyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
|---|---|
| PubChem CID | 23904704 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | prop-2-enyl 4-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(-c2ccc(C=Nn3cnnc3)o2)cc1 |
| InChI | InChI=1S/C17H14N4O3/c1-2-9-23-17(22)14-5-3-13(4-6-14)16-8-7-15(24-16)10-20-21-11-18-19-12-21/h2-8,10-12H,1,9H2 |
| InChIKey | SYYNCFUBQITSNP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|