C13H9FN4O — CID 5395923
(Z)-1-[5-(4-fluorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5395923) has the molecular formula C13H9FN4O and a molecular weight of 256.24 g/mol. Its IUPAC name is (Z)-1-[5-(4-fluorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[5-(4-fluorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5395923 |
| Molecular Formula | C13H9FN4O |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (Z)-1-[5-(4-fluorophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Fc1ccc(-c2ccc(/C=N\n3cnnc3)o2)cc1 |
| InChI | InChI=1S/C13H9FN4O/c14-11-3-1-10(2-4-11)13-6-5-12(19-13)7-17-18-8-15-16-9-18/h1-9H/b17-7- |
| InChIKey | AHVNPEWVKSASMS-IDUWFGFVSA-N |
| XLogP | 2.56 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|