C11H13N5O2 — CID 21381413
(Z)-1-(5-morpholin-4-ylfuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 21381413) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is (Z)-1-(5-morpholin-4-ylfuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(5-morpholin-4-ylfuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 21381413 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (Z)-1-(5-morpholin-4-ylfuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | C(=N\n1cnnc1)\c1ccc(N2CCOCC2)o1 |
| InChI | InChI=1S/C11H13N5O2/c1-2-11(15-3-5-17-6-4-15)18-10(1)7-14-16-8-12-13-9-16/h1-2,7-9H,3-6H2/b14-7- |
| InChIKey | BSNGPUXBWRMGAV-AUWJEWJLSA-N |
| XLogP | 0.59 |
| TPSA | 68.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|