C25H21N3O4S — CID 126027637
5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126027637) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126027637 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1C(=Cc2ccc(N3CCOCC3)o2)C(=O)N(c2ccccc2)C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C25H21N3O4S/c29-23-21(17-20-11-12-22(32-20)26-13-15-31-16-14-26)24(30)28(19-9-5-2-6-10-19)25(33)27(23)18-7-3-1-4-8-18/h1-12,17H,13-16H2 |
| InChIKey | XIFZFNFOYIYLEJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|