C18H17N3O3 — CID 6368616
(4Z)-1-phenyl-4-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]pyrazolidine-3,5-dione (PubChem CID 6368616) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is (4Z)-1-phenyl-4-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4Z)-1-phenyl-4-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 6368616 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (4Z)-1-phenyl-4-[(5-pyrrolidin-1-ylfuran-2-yl)methylidene]pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C\c1ccc(N2CCCC2)o1 |
| InChI | InChI=1S/C18H17N3O3/c22-17-15(18(23)21(19-17)13-6-2-1-3-7-13)12-14-8-9-16(24-14)20-10-4-5-11-20/h1-3,6-9,12H,4-5,10-11H2,(H,19,22)/b15-12- |
| InChIKey | UHFILINHYQNIPS-QINSGFPZSA-N |
| XLogP | 2.34 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|