C23H23N3O5S — CID 56696009
methyl 4-[(5Z)-3-methyl-4,6-dioxo-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoate (PubChem CID 56696009) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is methyl 4-[(5Z)-3-methyl-4,6-dioxo-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5Z)-3-methyl-4,6-dioxo-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 56696009 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | methyl 4-[(5Z)-3-methyl-4,6-dioxo-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)/C(=C\c3ccc(N4CCCCC4)o3)C(=O)N(C)C2=S)cc1 |
| InChI | InChI=1S/C23H23N3O5S/c1-24-20(27)18(14-17-10-11-19(31-17)25-12-4-3-5-13-25)21(28)26(23(24)32)16-8-6-15(7-9-16)22(29)30-2/h6-11,14H,3-5,12-13H2,1-2H3/b18-14- |
| InChIKey | QUCWRHADAOAWDM-JXAWBTAJSA-N |
| XLogP | 3.23 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|