C22H27N7O4S — CID 10874569
5-ethyl-4-[(E)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 10874569) has the molecular formula C22H27N7O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is 5-ethyl-4-[(E)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-ethyl-4-[(E)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 10874569 |
| Molecular Formula | C22H27N7O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 5-ethyl-4-[(E)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CCc1nn(CN2CCN(C)CC2)c(=S)n1/N=C/c1ccc(-c2ccc(OC)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C22H27N7O4S/c1-4-21-24-27(15-26-11-9-25(2)10-12-26)22(34)28(21)23-14-17-6-8-20(33-17)18-7-5-16(32-3)13-19(18)29(30)31/h5-8,13-14H,4,9-12,15H2,1-3H3/b23-14+ |
| InChIKey | XSKJJJOGJXXHTM-OEAKJJBVSA-N |
| XLogP | 3.24 |
| TPSA | 107.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|