C22H27N9O2S2 — CID 25267879
5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione (PubChem CID 25267879) has the molecular formula C22H27N9O2S2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione.
| Compound Name | 5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25267879 |
| Molecular Formula | C22H27N9O2S2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione |
| SMILES | Cc1cc(C)nc(SCc2nn(CN3CCN(C)CC3)c(=S)n2/N=C/c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C22H27N9O2S2/c1-16-12-17(2)25-21(24-16)35-14-20-26-29(15-28-10-8-27(3)9-11-28)22(34)30(20)23-13-18-4-6-19(7-5-18)31(32)33/h4-7,12-13H,8-11,14-15H2,1-3H3/b23-13+ |
| InChIKey | HAUZVKJXELGZPP-YDZHTSKRSA-N |
| XLogP | 3.11 |
| TPSA | 110.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|