C21H25N9O2S2 — CID 25267876
2-[(4-methylpiperazin-1-yl)methyl]-5-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione (PubChem CID 25267876) has the molecular formula C21H25N9O2S2 and a molecular weight of 499.63 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methyl]-5-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-methylpiperazin-1-yl)methyl]-5-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25267876 |
| Molecular Formula | C21H25N9O2S2 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methyl]-5-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-4-[(E)-(4-nitrophenyl)methylideneamino]-1,2,4-triazole-3-thione |
| SMILES | Cc1ccnc(SCc2nn(CN3CCN(C)CC3)c(=S)n2/N=C/c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H25N9O2S2/c1-16-7-8-22-20(24-16)34-14-19-25-28(15-27-11-9-26(2)10-12-27)21(33)29(19)23-13-17-3-5-18(6-4-17)30(31)32/h3-8,13H,9-12,14-15H2,1-2H3/b23-13+ |
| InChIKey | TYJKFOOISQJABC-YDZHTSKRSA-N |
| XLogP | 2.80 |
| TPSA | 110.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|