C20H24F3N5O2S2 — CID 24605113
2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 24605113) has the molecular formula C20H24F3N5O2S2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 24605113 |
| Molecular Formula | C20H24F3N5O2S2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 2-[[benzyl(2,2,2-trifluoroethyl)amino]methyl]-N,N-diethyl-3-sulfanylidene-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nn(CN(Cc3ccccc3)CC(F)(F)F)c(=S)n2c1 |
| InChI | InChI=1S/C20H24F3N5O2S2/c1-3-26(4-2)32(29,30)17-10-11-18-24-28(19(31)27(18)13-17)15-25(14-20(21,22)23)12-16-8-6-5-7-9-16/h5-11,13H,3-4,12,14-15H2,1-2H3 |
| InChIKey | QOMKIRJMQSCOCN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|