C23H21N5O2S — CID 10320543
5-(4,6-diphenylpyrimidin-2-yl)-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione (PubChem CID 10320543) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is 5-(4,6-diphenylpyrimidin-2-yl)-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4,6-diphenylpyrimidin-2-yl)-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 10320543 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 5-(4,6-diphenylpyrimidin-2-yl)-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)nn1CN1CCOCC1 |
| InChI | InChI=1S/C23H21N5O2S/c31-23-28(16-27-11-13-29-14-12-27)26-22(30-23)21-24-19(17-7-3-1-4-8-17)15-20(25-21)18-9-5-2-6-10-18/h1-10,15H,11-14,16H2 |
| InChIKey | UZSHRWBRKSWHNZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|