C19H18ClN5O4S — CID 10049298
5-[4-(4-chloroanilino)-3-nitrophenyl]-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione (PubChem CID 10049298) has the molecular formula C19H18ClN5O4S and a molecular weight of 447.90 g/mol. Its IUPAC name is 5-[4-(4-chloroanilino)-3-nitrophenyl]-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[4-(4-chloroanilino)-3-nitrophenyl]-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 10049298 |
| Molecular Formula | C19H18ClN5O4S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 5-[4-(4-chloroanilino)-3-nitrophenyl]-3-(morpholin-4-ylmethyl)-1,3,4-oxadiazole-2-thione |
| SMILES | O=[N+]([O-])c1cc(-c2nn(CN3CCOCC3)c(=S)o2)ccc1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN5O4S/c20-14-2-4-15(5-3-14)21-16-6-1-13(11-17(16)25(26)27)18-22-24(19(30)29-18)12-23-7-9-28-10-8-23/h1-6,11,21H,7-10,12H2 |
| InChIKey | KWHZYYIQYXHPKZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|