C16H20N6O4 — CID 133446904
N-(2,4-dinitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine (PubChem CID 133446904) has the molecular formula C16H20N6O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine.
| Compound Name | N-(2,4-dinitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 133446904 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-(2,4-dinitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2cnn(CCN3CCCCC3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N6O4/c23-21(24)14-4-5-15(16(10-14)22(25)26)18-13-11-17-20(12-13)9-8-19-6-2-1-3-7-19/h4-5,10-12,18H,1-3,6-9H2 |
| InChIKey | XDOCMTDPGZRYLW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|