C18H25N5O4 — CID 133446885
N-(4,5-dimethoxy-2-nitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine (PubChem CID 133446885) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-nitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine.
| Compound Name | N-(4,5-dimethoxy-2-nitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 133446885 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-(4,5-dimethoxy-2-nitrophenyl)-1-(2-piperidin-1-ylethyl)pyrazol-4-amine |
| SMILES | COc1cc(Nc2cnn(CCN3CCCCC3)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H25N5O4/c1-26-17-10-15(16(23(24)25)11-18(17)27-2)20-14-12-19-22(13-14)9-8-21-6-4-3-5-7-21/h10-13,20H,3-9H2,1-2H3 |
| InChIKey | UNOZVTSHVHESEW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|