C26H29Cl2N5O5 — CID 87824427
3-(4-benzylpiperazin-1-yl)-1-[4-(2,4-dinitroanilino)phenyl]propan-1-one;dihydrochloride (PubChem CID 87824427) has the molecular formula C26H29Cl2N5O5 and a molecular weight of 562.45 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-1-[4-(2,4-dinitroanilino)phenyl]propan-1-one;dihydrochloride.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-1-[4-(2,4-dinitroanilino)phenyl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 87824427 |
| Molecular Formula | C26H29Cl2N5O5 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-1-[4-(2,4-dinitroanilino)phenyl]propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCN1CCN(Cc2ccccc2)CC1)c1ccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H27N5O5.2ClH/c32-26(12-13-28-14-16-29(17-15-28)19-20-4-2-1-3-5-20)21-6-8-22(9-7-21)27-24-11-10-23(30(33)34)18-25(24)31(35)36;;/h1-11,18,27H,12-17,19H2;2*1H |
| InChIKey | MTYULAKCWBRWMP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|