C20H23Cl2F2N3O3 — CID 10161777
3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one;dihydrochloride (PubChem CID 10161777) has the molecular formula C20H23Cl2F2N3O3 and a molecular weight of 462.32 g/mol. Its IUPAC name is 3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one;dihydrochloride.
| Compound Name | 3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 10161777 |
| Molecular Formula | C20H23Cl2F2N3O3 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCN1CCN(Cc2cc(F)ccc2F)CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21F2N3O3.2ClH/c21-17-3-6-19(22)16(13-17)14-24-11-9-23(10-12-24)8-7-20(26)15-1-4-18(5-2-15)25(27)28;;/h1-6,13H,7-12,14H2;2*1H |
| InChIKey | UBCURBHLMYNXNW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|