C20H21F2N3O3 — CID 10161778
3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one (PubChem CID 10161778) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one.
| Compound Name | 3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 10161778 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]-1-(4-nitrophenyl)propan-1-one |
| SMILES | O=C(CCN1CCN(Cc2cc(F)ccc2F)CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21F2N3O3/c21-17-3-6-19(22)16(13-17)14-24-11-9-23(10-12-24)8-7-20(26)15-1-4-18(5-2-15)25(27)28/h1-6,13H,7-12,14H2 |
| InChIKey | DQVNZMKWBSCRCJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|