C21H24N4O6 — CID 141030273
4-[3-[(4-ethoxycarbonylpiperazin-1-yl)methyl]anilino]-3-nitrobenzoic acid (PubChem CID 141030273) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is 4-[3-[(4-ethoxycarbonylpiperazin-1-yl)methyl]anilino]-3-nitrobenzoic acid.
| Compound Name | 4-[3-[(4-ethoxycarbonylpiperazin-1-yl)methyl]anilino]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 141030273 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-[3-[(4-ethoxycarbonylpiperazin-1-yl)methyl]anilino]-3-nitrobenzoic acid |
| SMILES | CCOC(=O)N1CCN(Cc2cccc(Nc3ccc(C(=O)O)cc3[N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H24N4O6/c1-2-31-21(28)24-10-8-23(9-11-24)14-15-4-3-5-17(12-15)22-18-7-6-16(20(26)27)13-19(18)25(29)30/h3-7,12-13,22H,2,8-11,14H2,1H3,(H,26,27) |
| InChIKey | PKRCFHUQBLCKAN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|