C21H25N3O4 — CID 22741906
ethyl 4-[3-(1-methylpiperidin-3-yl)anilino]-3-nitrobenzoate (PubChem CID 22741906) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl 4-[3-(1-methylpiperidin-3-yl)anilino]-3-nitrobenzoate.
| Compound Name | ethyl 4-[3-(1-methylpiperidin-3-yl)anilino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 22741906 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | ethyl 4-[3-(1-methylpiperidin-3-yl)anilino]-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cccc(C3CCCN(C)C3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25N3O4/c1-3-28-21(25)16-9-10-19(20(13-16)24(26)27)22-18-8-4-6-15(12-18)17-7-5-11-23(2)14-17/h4,6,8-10,12-13,17,22H,3,5,7,11,14H2,1-2H3 |
| InChIKey | KMHLOMMXCIVLAL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|