C24H27ClN6OS — CID 31253027
2-[4-[[3-(4-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperazin-1-yl]-N-phenylacetamide (PubChem CID 31253027) has the molecular formula C24H27ClN6OS and a molecular weight of 483.04 g/mol. Its IUPAC name is 2-[4-[[3-(4-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[3-(4-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 31253027 |
| Molecular Formula | C24H27ClN6OS |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-[4-[[3-(4-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperazin-1-yl]-N-phenylacetamide |
| SMILES | C=CCn1c(-c2ccc(Cl)cc2)nn(CN2CCN(CC(=O)Nc3ccccc3)CC2)c1=S |
| InChI | InChI=1S/C24H27ClN6OS/c1-2-12-30-23(19-8-10-20(25)11-9-19)27-31(24(30)33)18-29-15-13-28(14-16-29)17-22(32)26-21-6-4-3-5-7-21/h2-11H,1,12-18H2,(H,26,32) |
| InChIKey | PMSDFOCBLDOVHX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|