C20H24N6OS — CID 135476535
4-ethyl-5-(4-hydroxyphenyl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 135476535) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-ethyl-5-(4-hydroxyphenyl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-ethyl-5-(4-hydroxyphenyl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 135476535 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-ethyl-5-(4-hydroxyphenyl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccc(O)cc2)nn(CN2CCN(c3ccccn3)CC2)c1=S |
| InChI | InChI=1S/C20H24N6OS/c1-2-25-19(16-6-8-17(27)9-7-16)22-26(20(25)28)15-23-11-13-24(14-12-23)18-5-3-4-10-21-18/h3-10,27H,2,11-15H2,1H3 |
| InChIKey | GYZCLOKJIMKYBQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|