C19H26N5O2+ — CID 9445490
(2R)-N-(2-methoxy-5-methylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide (PubChem CID 9445490) has the molecular formula C19H26N5O2+ and a molecular weight of 356.45 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-5-methylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(2-methoxy-5-methylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 9445490 |
| Molecular Formula | C19H26N5O2+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (2R)-N-(2-methoxy-5-methylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)propanamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H](C)[NH+]1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H25N5O2/c1-14-5-6-17(26-3)16(13-14)22-18(25)15(2)23-9-11-24(12-10-23)19-20-7-4-8-21-19/h4-8,13,15H,9-12H2,1-3H3,(H,22,25)/p+1/t15-/m1/s1 |
| InChIKey | MSWOEXUVCTWSJR-OAHLLOKOSA-O |
| XLogP | 0.53 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |