C17H27N2O2+ — CID 9249893
(2S)-2-(azepan-1-ium-1-yl)-N-(2-methoxy-5-methylphenyl)propanamide (PubChem CID 9249893) has the molecular formula C17H27N2O2+ and a molecular weight of 291.42 g/mol. Its IUPAC name is (2S)-2-(azepan-1-ium-1-yl)-N-(2-methoxy-5-methylphenyl)propanamide.
| Compound Name | (2S)-2-(azepan-1-ium-1-yl)-N-(2-methoxy-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 9249893 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (2S)-2-(azepan-1-ium-1-yl)-N-(2-methoxy-5-methylphenyl)propanamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](C)[NH+]1CCCCCC1 |
| InChI | InChI=1S/C17H26N2O2/c1-13-8-9-16(21-3)15(12-13)18-17(20)14(2)19-10-6-4-5-7-11-19/h8-9,12,14H,4-7,10-11H2,1-3H3,(H,18,20)/p+1/t14-/m0/s1 |
| InChIKey | KOQOGOQOHVQLLS-AWEZNQCLSA-O |
| XLogP | 1.79 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |