C13H20N7S+ — CID 9232362
4-ethyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 9232362) has the molecular formula C13H20N7S+ and a molecular weight of 306.42 g/mol. Its IUPAC name is 4-ethyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-ethyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9232362 |
| Molecular Formula | C13H20N7S+ |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-ethyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CCn1cnn(C[NH+]2CCN(c3ncccn3)CC2)c1=S |
| InChI | InChI=1S/C13H19N7S/c1-2-18-10-16-20(13(18)21)11-17-6-8-19(9-7-17)12-14-4-3-5-15-12/h3-5,10H,2,6-9,11H2,1H3/p+1 |
| InChIKey | QXRHYRAOGVEMLV-UHFFFAOYSA-O |
| XLogP | -0.41 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|