C14H19N4S+ — CID 6936919
2-[4-[(3-methylthiophen-2-yl)methyl]piperazin-4-ium-1-yl]pyrimidine (PubChem CID 6936919) has the molecular formula C14H19N4S+ and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-[4-[(3-methylthiophen-2-yl)methyl]piperazin-4-ium-1-yl]pyrimidine.
| Compound Name | 2-[4-[(3-methylthiophen-2-yl)methyl]piperazin-4-ium-1-yl]pyrimidine |
|---|---|
| PubChem CID | 6936919 |
| Molecular Formula | C14H19N4S+ |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[4-[(3-methylthiophen-2-yl)methyl]piperazin-4-ium-1-yl]pyrimidine |
| SMILES | Cc1ccsc1C[NH+]1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H18N4S/c1-12-3-10-19-13(12)11-17-6-8-18(9-7-17)14-15-4-2-5-16-14/h2-5,10H,6-9,11H2,1H3/p+1 |
| InChIKey | YWRMOABUHGIJPP-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |