C17H24N7S+ — CID 9232328
4,5-dicyclopropyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 9232328) has the molecular formula C17H24N7S+ and a molecular weight of 358.50 g/mol. Its IUPAC name is 4,5-dicyclopropyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4,5-dicyclopropyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9232328 |
| Molecular Formula | C17H24N7S+ |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4,5-dicyclopropyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | S=c1n(C[NH+]2CCN(c3ncccn3)CC2)nc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C17H23N7S/c25-17-23(20-15(13-2-3-13)24(17)14-4-5-14)12-21-8-10-22(11-9-21)16-18-6-1-7-19-16/h1,6-7,13-14H,2-5,8-12H2/p+1 |
| InChIKey | FYKJIDLFSIETDY-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|