C21H28N4S — CID 9193437
2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dicyclopropyl-1,2,4-triazole-3-thione (PubChem CID 9193437) has the molecular formula C21H28N4S and a molecular weight of 368.55 g/mol. Its IUPAC name is 2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dicyclopropyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dicyclopropyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9193437 |
| Molecular Formula | C21H28N4S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dicyclopropyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCC(Cc3ccccc3)CC2)nc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C21H28N4S/c26-21-24(22-20(18-6-7-18)25(21)19-8-9-19)15-23-12-10-17(11-13-23)14-16-4-2-1-3-5-16/h1-5,17-19H,6-15H2 |
| InChIKey | BRNMCRDUQLTQQP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|